C25H26FNO2 — CID 7961623
4-[(4-tert-butylphenoxy)methyl]-N-(5-fluoro-2-methylphenyl)benzamide (PubChem CID 7961623) has the molecular formula C25H26FNO2 and a molecular weight of 391.49 g/mol. Its IUPAC name is 4-[(4-tert-butylphenoxy)methyl]-N-(5-fluoro-2-methylphenyl)benzamide.
| Compound Name | 4-[(4-tert-butylphenoxy)methyl]-N-(5-fluoro-2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 7961623 |
| Molecular Formula | C25H26FNO2 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 4-[(4-tert-butylphenoxy)methyl]-N-(5-fluoro-2-methylphenyl)benzamide |
| SMILES | Cc1ccc(F)cc1NC(=O)c1ccc(COc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H26FNO2/c1-17-5-12-21(26)15-23(17)27-24(28)19-8-6-18(7-9-19)16-29-22-13-10-20(11-14-22)25(2,3)4/h5-15H,16H2,1-4H3,(H,27,28) |
| InChIKey | ONTLEQQSIZWFJQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |