C27H26FN3O2S2 — CID 2469636
4-[(4-tert-butylphenoxy)methyl]-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 2469636) has the molecular formula C27H26FN3O2S2 and a molecular weight of 507.66 g/mol. Its IUPAC name is 4-[(4-tert-butylphenoxy)methyl]-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-[(4-tert-butylphenoxy)methyl]-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 2469636 |
| Molecular Formula | C27H26FN3O2S2 |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 4-[(4-tert-butylphenoxy)methyl]-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(OCc2ccc(C(=O)Nc3nnc(SCc4ccc(F)cc4)s3)cc2)cc1 |
| InChI | InChI=1S/C27H26FN3O2S2/c1-27(2,3)21-10-14-23(15-11-21)33-16-18-4-8-20(9-5-18)24(32)29-25-30-31-26(35-25)34-17-19-6-12-22(28)13-7-19/h4-15H,16-17H2,1-3H3,(H,29,30,32) |
| InChIKey | CHZRMZUNQSZRJT-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|