C24H22N4O3S3 — CID 177374796
N-[5-[(4-tert-butylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzamide (PubChem CID 177374796) has the molecular formula C24H22N4O3S3 and a molecular weight of 510.67 g/mol. Its IUPAC name is N-[5-[(4-tert-butylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzamide.
| Compound Name | N-[5-[(4-tert-butylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzamide |
|---|---|
| PubChem CID | 177374796 |
| Molecular Formula | C24H22N4O3S3 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | N-[5-[(4-tert-butylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzamide |
| SMILES | CC(C)(C)c1ccc(CSc2nnc(NC(=O)c3ccc(/C=C4\SC(=O)NC4=O)cc3)s2)cc1 |
| InChI | InChI=1S/C24H22N4O3S3/c1-24(2,3)17-10-6-15(7-11-17)13-32-23-28-27-21(34-23)25-19(29)16-8-4-14(5-9-16)12-18-20(30)26-22(31)33-18/h4-12H,13H2,1-3H3,(H,25,27,29)(H,26,30,31)/b18-12- |
| InChIKey | HODMQWXDYVLKHK-PDGQHHTCSA-N |
| XLogP | 5.70 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|