C21H23N3O2S2 — CID 42805440
N-[5-[(4-tert-butylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-methoxybenzamide (PubChem CID 42805440) has the molecular formula C21H23N3O2S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is N-[5-[(4-tert-butylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-methoxybenzamide.
| Compound Name | N-[5-[(4-tert-butylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 42805440 |
| Molecular Formula | C21H23N3O2S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-[5-[(4-tert-butylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2nnc(SCc3ccc(C(C)(C)C)cc3)s2)c1 |
| InChI | InChI=1S/C21H23N3O2S2/c1-21(2,3)16-10-8-14(9-11-16)13-27-20-24-23-19(28-20)22-18(25)15-6-5-7-17(12-15)26-4/h5-12H,13H2,1-4H3,(H,22,23,25) |
| InChIKey | VJDMWVKYSAQMHU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|