C17H11BrF3N3OS2 — CID 5165487
3-bromo-N-[5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 5165487) has the molecular formula C17H11BrF3N3OS2 and a molecular weight of 474.33 g/mol. Its IUPAC name is 3-bromo-N-[5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-bromo-N-[5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 5165487 |
| Molecular Formula | C17H11BrF3N3OS2 |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 472.95 |
| IUPAC Name | 3-bromo-N-[5-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(SCc2ccc(C(F)(F)F)cc2)s1)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H11BrF3N3OS2/c18-13-3-1-2-11(8-13)14(25)22-15-23-24-16(27-15)26-9-10-4-6-12(7-5-10)17(19,20)21/h1-8H,9H2,(H,22,23,25) |
| InChIKey | CAWOAMHCBZEJHW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|