C17H12F3N3OS2 — CID 8800607
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)benzamide (PubChem CID 8800607) has the molecular formula C17H12F3N3OS2 and a molecular weight of 395.43 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 8800607 |
| Molecular Formula | C17H12F3N3OS2 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2)s1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F3N3OS2/c18-17(19,20)13-8-4-7-12(9-13)14(24)21-15-22-23-16(26-15)25-10-11-5-2-1-3-6-11/h1-9H,10H2,(H,21,22,24) |
| InChIKey | PDNCXVMFMKKDGE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|