C20H15F3N4O2S2 — CID 4625526
N-[5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(trifluoromethyl)benzamide (PubChem CID 4625526) has the molecular formula C20H15F3N4O2S2 and a molecular weight of 464.49 g/mol. Its IUPAC name is N-[5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 4625526 |
| Molecular Formula | C20H15F3N4O2S2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-[5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nnc(SCC(=O)N2CCc3ccccc32)s1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H15F3N4O2S2/c21-20(22,23)14-6-3-5-13(10-14)17(29)24-18-25-26-19(31-18)30-11-16(28)27-9-8-12-4-1-2-7-15(12)27/h1-7,10H,8-9,11H2,(H,24,25,29) |
| InChIKey | PFDSFUUQGKTYGU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|