C17H14N4O2S3 — CID 5051757
N-[5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide (PubChem CID 5051757) has the molecular formula C17H14N4O2S3 and a molecular weight of 402.53 g/mol. Its IUPAC name is N-[5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 5051757 |
| Molecular Formula | C17H14N4O2S3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | N-[5-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1nnc(SCC(=O)N2CCc3ccccc32)s1)c1cccs1 |
| InChI | InChI=1S/C17H14N4O2S3/c22-14(21-8-7-11-4-1-2-5-12(11)21)10-25-17-20-19-16(26-17)18-15(23)13-6-3-9-24-13/h1-6,9H,7-8,10H2,(H,18,19,23) |
| InChIKey | IBMOEMKYLRDKJY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|