C12H9N3OS4 — CID 51199300
N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide (PubChem CID 51199300) has the molecular formula C12H9N3OS4 and a molecular weight of 339.49 g/mol. Its IUPAC name is N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 51199300 |
| Molecular Formula | C12H9N3OS4 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 338.96 |
| IUPAC Name | N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2cccs2)s1)c1cccs1 |
| InChI | InChI=1S/C12H9N3OS4/c16-10(9-4-2-6-18-9)13-11-14-15-12(20-11)19-7-8-3-1-5-17-8/h1-6H,7H2,(H,13,14,16) |
| InChIKey | IOFFGYGGXQJEGH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|