C13H15N3O2S3 — CID 75413098
N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]oxane-4-carboxamide (PubChem CID 75413098) has the molecular formula C13H15N3O2S3 and a molecular weight of 341.48 g/mol. Its IUPAC name is N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]oxane-4-carboxamide.
| Compound Name | N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 75413098 |
| Molecular Formula | C13H15N3O2S3 |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]oxane-4-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2cccs2)s1)C1CCOCC1 |
| InChI | InChI=1S/C13H15N3O2S3/c17-11(9-3-5-18-6-4-9)14-12-15-16-13(21-12)20-8-10-2-1-7-19-10/h1-2,7,9H,3-6,8H2,(H,14,15,17) |
| InChIKey | LQXIZJPWKDBLLW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|