C19H19FN4O3S4 — CID 55414484
1-(4-fluorophenyl)sulfonyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-3-carboxamide (PubChem CID 55414484) has the molecular formula C19H19FN4O3S4 and a molecular weight of 498.65 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55414484 |
| Molecular Formula | C19H19FN4O3S4 |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2cccs2)s1)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H19FN4O3S4/c20-14-5-7-16(8-6-14)31(26,27)24-9-1-3-13(11-24)17(25)21-18-22-23-19(30-18)29-12-15-4-2-10-28-15/h2,4-8,10,13H,1,3,9,11-12H2,(H,21,22,25) |
| InChIKey | BLJZGNHEKHXRRZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|