C22H23FN2O3S3 — CID 46401961
1-(4-fluorophenyl)sulfonyl-N,N-bis(thiophen-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 46401961) has the molecular formula C22H23FN2O3S3 and a molecular weight of 478.64 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N,N-bis(thiophen-2-ylmethyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N,N-bis(thiophen-2-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46401961 |
| Molecular Formula | C22H23FN2O3S3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N,N-bis(thiophen-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C22H23FN2O3S3/c23-18-7-9-21(10-8-18)31(27,28)25-11-1-4-17(14-25)22(26)24(15-19-5-2-12-29-19)16-20-6-3-13-30-20/h2-3,5-10,12-13,17H,1,4,11,14-16H2 |
| InChIKey | INBOVWRGKIAYOA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |