C14H18N4O3S4 — CID 133231097
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 133231097) has the molecular formula C14H18N4O3S4 and a molecular weight of 418.59 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 133231097 |
| Molecular Formula | C14H18N4O3S4 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CCSc1nnc(NC(=O)C2CCCN(S(=O)(=O)c3cccs3)C2)s1 |
| InChI | InChI=1S/C14H18N4O3S4/c1-2-22-14-17-16-13(24-14)15-12(19)10-5-3-7-18(9-10)25(20,21)11-6-4-8-23-11/h4,6,8,10H,2-3,5,7,9H2,1H3,(H,15,16,19) |
| InChIKey | YJWMNDOOLRXZJH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|