C18H20Cl2N4O5S3 — CID 133178587
methyl 2-[[5-[[1-[(2,6-dichlorophenyl)methylsulfonyl]piperidine-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 133178587) has the molecular formula C18H20Cl2N4O5S3 and a molecular weight of 539.49 g/mol. Its IUPAC name is methyl 2-[[5-[[1-[(2,6-dichlorophenyl)methylsulfonyl]piperidine-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[[1-[(2,6-dichlorophenyl)methylsulfonyl]piperidine-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 133178587 |
| Molecular Formula | C18H20Cl2N4O5S3 |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 538.00 |
| IUPAC Name | methyl 2-[[5-[[1-[(2,6-dichlorophenyl)methylsulfonyl]piperidine-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)C2CCCN(S(=O)(=O)Cc3c(Cl)cccc3Cl)C2)s1 |
| InChI | InChI=1S/C18H20Cl2N4O5S3/c1-29-15(25)9-30-18-23-22-17(31-18)21-16(26)11-4-3-7-24(8-11)32(27,28)10-12-13(19)5-2-6-14(12)20/h2,5-6,11H,3-4,7-10H2,1H3,(H,21,22,26) |
| InChIKey | MRUQIEZQOQAXQW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|