C18H23ClN4O3S3 — CID 133160709
1-[(3-chlorophenyl)methylsulfonyl]-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide (PubChem CID 133160709) has the molecular formula C18H23ClN4O3S3 and a molecular weight of 475.06 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methylsulfonyl]-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methylsulfonyl]-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133160709 |
| Molecular Formula | C18H23ClN4O3S3 |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 1-[(3-chlorophenyl)methylsulfonyl]-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide |
| SMILES | CC(C)Sc1nnc(NC(=O)C2CCCN(S(=O)(=O)Cc3cccc(Cl)c3)C2)s1 |
| InChI | InChI=1S/C18H23ClN4O3S3/c1-12(2)27-18-22-21-17(28-18)20-16(24)14-6-4-8-23(10-14)29(25,26)11-13-5-3-7-15(19)9-13/h3,5,7,9,12,14H,4,6,8,10-11H2,1-2H3,(H,20,21,24) |
| InChIKey | CMMFWWICDSIWDQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|