C19H25ClN4O3S3 — CID 133251895
1-[(4-chlorophenyl)methylsulfonyl]-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-3-carboxamide (PubChem CID 133251895) has the molecular formula C19H25ClN4O3S3 and a molecular weight of 489.09 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methylsulfonyl]-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methylsulfonyl]-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133251895 |
| Molecular Formula | C19H25ClN4O3S3 |
| Molecular Weight | 489.09 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 1-[(4-chlorophenyl)methylsulfonyl]-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-3-carboxamide |
| SMILES | CC(C)CSc1nnc(NC(=O)C2CCCN(S(=O)(=O)Cc3ccc(Cl)cc3)C2)s1 |
| InChI | InChI=1S/C19H25ClN4O3S3/c1-13(2)11-28-19-23-22-18(29-19)21-17(25)15-4-3-9-24(10-15)30(26,27)12-14-5-7-16(20)8-6-14/h5-8,13,15H,3-4,9-12H2,1-2H3,(H,21,22,25) |
| InChIKey | XMCRCCIQEDXXCT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.09 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|