C21H30N4O3S3 — CID 133261979
N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide (PubChem CID 133261979) has the molecular formula C21H30N4O3S3 and a molecular weight of 482.70 g/mol. Its IUPAC name is N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide.
| Compound Name | N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133261979 |
| Molecular Formula | C21H30N4O3S3 |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide |
| SMILES | CC(C)CSc1nnc(NC(=O)C2CCCN(S(=O)(=O)CCCc3ccccc3)C2)s1 |
| InChI | InChI=1S/C21H30N4O3S3/c1-16(2)15-29-21-24-23-20(30-21)22-19(26)18-11-6-12-25(14-18)31(27,28)13-7-10-17-8-4-3-5-9-17/h3-5,8-9,16,18H,6-7,10-15H2,1-2H3,(H,22,23,26) |
| InChIKey | VDWGZRKSSWOQID-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|