C18H21ClN4O5S3 — CID 100600185
methyl 2-[[5-[[1-[(4-chlorophenyl)methylsulfonyl]piperidine-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 100600185) has the molecular formula C18H21ClN4O5S3 and a molecular weight of 505.04 g/mol. Its IUPAC name is methyl 2-[[5-[[1-[(4-chlorophenyl)methylsulfonyl]piperidine-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[[1-[(4-chlorophenyl)methylsulfonyl]piperidine-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 100600185 |
| Molecular Formula | C18H21ClN4O5S3 |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | methyl 2-[[5-[[1-[(4-chlorophenyl)methylsulfonyl]piperidine-4-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)C2CCN(S(=O)(=O)Cc3ccc(Cl)cc3)CC2)s1 |
| InChI | InChI=1S/C18H21ClN4O5S3/c1-28-15(24)10-29-18-22-21-17(30-18)20-16(25)13-6-8-23(9-7-13)31(26,27)11-12-2-4-14(19)5-3-12/h2-5,13H,6-11H2,1H3,(H,20,21,25) |
| InChIKey | GLBWDJWJBSIUOA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|