C20H26ClN5O4S3 — CID 3718398
1-(4-chlorophenyl)sulfonyl-N-[5-[2-(diethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide (PubChem CID 3718398) has the molecular formula C20H26ClN5O4S3 and a molecular weight of 532.11 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-[5-[2-(diethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-[5-[2-(diethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3718398 |
| Molecular Formula | C20H26ClN5O4S3 |
| Molecular Weight | 532.11 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-[5-[2-(diethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)CSc1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)s1 |
| InChI | InChI=1S/C20H26ClN5O4S3/c1-3-25(4-2)17(27)13-31-20-24-23-19(32-20)22-18(28)14-9-11-26(12-10-14)33(29,30)16-7-5-15(21)6-8-16/h5-8,14H,3-4,9-13H2,1-2H3,(H,22,23,28) |
| InChIKey | JKVXNMUIILAHCD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.11 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|