C22H21ClN4O4S3 — CID 17308400
N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 17308400) has the molecular formula C22H21ClN4O4S3 and a molecular weight of 537.09 g/mol. Its IUPAC name is N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 17308400 |
| Molecular Formula | C22H21ClN4O4S3 |
| Molecular Weight | 537.09 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN4O4S3/c23-17-8-4-15(5-9-17)19(28)14-32-22-26-25-21(33-22)24-20(29)16-6-10-18(11-7-16)34(30,31)27-12-2-1-3-13-27/h4-11H,1-3,12-14H2,(H,24,25,29) |
| InChIKey | YYNQCIOHMPCEOF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.09 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|