C20H20ClN5O5S3 — CID 100510355
4-chloro-N-[5-[(4-piperidin-1-ylsulfonylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100510355) has the molecular formula C20H20ClN5O5S3 and a molecular weight of 542.06 g/mol. Its IUPAC name is 4-chloro-N-[5-[(4-piperidin-1-ylsulfonylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[5-[(4-piperidin-1-ylsulfonylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100510355 |
| Molecular Formula | C20H20ClN5O5S3 |
| Molecular Weight | 542.06 g/mol |
| Exact Mass | 541.03 |
| IUPAC Name | 4-chloro-N-[5-[(4-piperidin-1-ylsulfonylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClN5O5S3/c21-15-6-4-14(5-7-15)18(27)22-19-23-24-20(32-19)33(28,29)25-16-8-10-17(11-9-16)34(30,31)26-12-2-1-3-13-26/h4-11,25H,1-3,12-13H2,(H,22,23,27) |
| InChIKey | PMMSFJALXSSUFL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.06 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|