C18H24ClN5O3S2 — CID 100504727
N-[5-[3-(azepan-1-yl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-chlorobenzamide (PubChem CID 100504727) has the molecular formula C18H24ClN5O3S2 and a molecular weight of 458.01 g/mol. Its IUPAC name is N-[5-[3-(azepan-1-yl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-chlorobenzamide.
| Compound Name | N-[5-[3-(azepan-1-yl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 100504727 |
| Molecular Formula | C18H24ClN5O3S2 |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-[5-[3-(azepan-1-yl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-chlorobenzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)NCCCN2CCCCCC2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClN5O3S2/c19-15-8-6-14(7-9-15)16(25)21-17-22-23-18(28-17)29(26,27)20-10-5-13-24-11-3-1-2-4-12-24/h6-9,20H,1-5,10-13H2,(H,21,22,25) |
| InChIKey | CWWKMNSPUNMJHF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|