C20H21ClN4O5S2 — CID 100520564
4-chloro-N-[5-[3-(3,4-dimethoxyphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100520564) has the molecular formula C20H21ClN4O5S2 and a molecular weight of 497.00 g/mol. Its IUPAC name is 4-chloro-N-[5-[3-(3,4-dimethoxyphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[5-[3-(3,4-dimethoxyphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100520564 |
| Molecular Formula | C20H21ClN4O5S2 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 4-chloro-N-[5-[3-(3,4-dimethoxyphenyl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc(CCCNS(=O)(=O)c2nnc(NC(=O)c3ccc(Cl)cc3)s2)cc1OC |
| InChI | InChI=1S/C20H21ClN4O5S2/c1-29-16-10-5-13(12-17(16)30-2)4-3-11-22-32(27,28)20-25-24-19(31-20)23-18(26)14-6-8-15(21)9-7-14/h5-10,12,22H,3-4,11H2,1-2H3,(H,23,24,26) |
| InChIKey | UWKGMBOGBFLNEE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|