C19H19ClN4O5S2 — CID 133167570
4-chloro-N-[5-[1-(2,5-dimethoxyphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 133167570) has the molecular formula C19H19ClN4O5S2 and a molecular weight of 482.97 g/mol. Its IUPAC name is 4-chloro-N-[5-[1-(2,5-dimethoxyphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[5-[1-(2,5-dimethoxyphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 133167570 |
| Molecular Formula | C19H19ClN4O5S2 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 4-chloro-N-[5-[1-(2,5-dimethoxyphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(C(C)NS(=O)(=O)c2nnc(NC(=O)c3ccc(Cl)cc3)s2)c1 |
| InChI | InChI=1S/C19H19ClN4O5S2/c1-11(15-10-14(28-2)8-9-16(15)29-3)24-31(26,27)19-23-22-18(30-19)21-17(25)12-4-6-13(20)7-5-12/h4-11,24H,1-3H3,(H,21,22,25) |
| InChIKey | IZHFVXXBWUZQER-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|