C21H23ClN4O3S2 — CID 133264494
N-[5-[1-(4-tert-butylphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-chlorobenzamide (PubChem CID 133264494) has the molecular formula C21H23ClN4O3S2 and a molecular weight of 479.03 g/mol. Its IUPAC name is N-[5-[1-(4-tert-butylphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-chlorobenzamide.
| Compound Name | N-[5-[1-(4-tert-butylphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 133264494 |
| Molecular Formula | C21H23ClN4O3S2 |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N-[5-[1-(4-tert-butylphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]-4-chlorobenzamide |
| SMILES | CC(NS(=O)(=O)c1nnc(NC(=O)c2ccc(Cl)cc2)s1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H23ClN4O3S2/c1-13(14-5-9-16(10-6-14)21(2,3)4)26-31(28,29)20-25-24-19(30-20)23-18(27)15-7-11-17(22)12-8-15/h5-13,26H,1-4H3,(H,23,24,27) |
| InChIKey | RZPJYLOUIGLXHF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|