C21H23ClN4O5S2 — CID 133187232
4-chloro-N-[5-[1-(3,4-diethoxyphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 133187232) has the molecular formula C21H23ClN4O5S2 and a molecular weight of 511.03 g/mol. Its IUPAC name is 4-chloro-N-[5-[1-(3,4-diethoxyphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[5-[1-(3,4-diethoxyphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 133187232 |
| Molecular Formula | C21H23ClN4O5S2 |
| Molecular Weight | 511.03 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 4-chloro-N-[5-[1-(3,4-diethoxyphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCOc1ccc(C(C)NS(=O)(=O)c2nnc(NC(=O)c3ccc(Cl)cc3)s2)cc1OCC |
| InChI | InChI=1S/C21H23ClN4O5S2/c1-4-30-17-11-8-15(12-18(17)31-5-2)13(3)26-33(28,29)21-25-24-20(32-21)23-19(27)14-6-9-16(22)10-7-14/h6-13,26H,4-5H2,1-3H3,(H,23,24,27) |
| InChIKey | SGBWRAMQLMCUEB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.03 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|