C13H14Cl2N4O3S2 — CID 133199546
N-[5-(butan-2-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2,4-dichlorobenzamide (PubChem CID 133199546) has the molecular formula C13H14Cl2N4O3S2 and a molecular weight of 409.32 g/mol. Its IUPAC name is N-[5-(butan-2-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[5-(butan-2-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 133199546 |
| Molecular Formula | C13H14Cl2N4O3S2 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | N-[5-(butan-2-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2,4-dichlorobenzamide |
| SMILES | CCC(C)NS(=O)(=O)c1nnc(NC(=O)c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C13H14Cl2N4O3S2/c1-3-7(2)19-24(21,22)13-18-17-12(23-13)16-11(20)9-5-4-8(14)6-10(9)15/h4-7,19H,3H2,1-2H3,(H,16,17,20) |
| InChIKey | HQXAJYREWKMGQQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|