C14H17ClN4O3S2 — CID 133178488
2-chloro-N-[5-(pentan-2-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 133178488) has the molecular formula C14H17ClN4O3S2 and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-chloro-N-[5-(pentan-2-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-(pentan-2-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 133178488 |
| Molecular Formula | C14H17ClN4O3S2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 2-chloro-N-[5-(pentan-2-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCCC(C)NS(=O)(=O)c1nnc(NC(=O)c2ccccc2Cl)s1 |
| InChI | InChI=1S/C14H17ClN4O3S2/c1-3-6-9(2)19-24(21,22)14-18-17-13(23-14)16-12(20)10-7-4-5-8-11(10)15/h4-5,7-9,19H,3,6H2,1-2H3,(H,16,17,20) |
| InChIKey | IPJYCFPPHLTUKZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|