C16H13ClN4O3S2 — CID 100513021
2-chloro-N-[5-[(3-methylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100513021) has the molecular formula C16H13ClN4O3S2 and a molecular weight of 408.89 g/mol. Its IUPAC name is 2-chloro-N-[5-[(3-methylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-[(3-methylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100513021 |
| Molecular Formula | C16H13ClN4O3S2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 2-chloro-N-[5-[(3-methylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2nnc(NC(=O)c3ccccc3Cl)s2)c1 |
| InChI | InChI=1S/C16H13ClN4O3S2/c1-10-5-4-6-11(9-10)21-26(23,24)16-20-19-15(25-16)18-14(22)12-7-2-3-8-13(12)17/h2-9,21H,1H3,(H,18,19,22) |
| InChIKey | JCVWQJXWRSBPBW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|