C15H10Cl2N4O3S2 — CID 100761553
2-chloro-N-[5-[(3-chlorophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100761553) has the molecular formula C15H10Cl2N4O3S2 and a molecular weight of 429.31 g/mol. Its IUPAC name is 2-chloro-N-[5-[(3-chlorophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-[(3-chlorophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100761553 |
| Molecular Formula | C15H10Cl2N4O3S2 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 427.96 |
| IUPAC Name | 2-chloro-N-[5-[(3-chlorophenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)Nc2cccc(Cl)c2)s1)c1ccccc1Cl |
| InChI | InChI=1S/C15H10Cl2N4O3S2/c16-9-4-3-5-10(8-9)21-26(23,24)15-20-19-14(25-15)18-13(22)11-6-1-2-7-12(11)17/h1-8,21H,(H,18,19,22) |
| InChIKey | GEUZKWFAPPEVEZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|