C21H20ClN5O4S2 — CID 100700425
2-chloro-N-[5-[[4-(piperidine-1-carbonyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100700425) has the molecular formula C21H20ClN5O4S2 and a molecular weight of 506.01 g/mol. Its IUPAC name is 2-chloro-N-[5-[[4-(piperidine-1-carbonyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-[[4-(piperidine-1-carbonyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100700425 |
| Molecular Formula | C21H20ClN5O4S2 |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 2-chloro-N-[5-[[4-(piperidine-1-carbonyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)Nc2ccc(C(=O)N3CCCCC3)cc2)s1)c1ccccc1Cl |
| InChI | InChI=1S/C21H20ClN5O4S2/c22-17-7-3-2-6-16(17)18(28)23-20-24-25-21(32-20)33(30,31)26-15-10-8-14(9-11-15)19(29)27-12-4-1-5-13-27/h2-3,6-11,26H,1,4-5,12-13H2,(H,23,24,28) |
| InChIKey | VSWVIYMAWMXYQB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|