C13H15ClN4O3S2 — CID 133201796
N-[5-(butan-2-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-chlorobenzamide (PubChem CID 133201796) has the molecular formula C13H15ClN4O3S2 and a molecular weight of 374.88 g/mol. Its IUPAC name is N-[5-(butan-2-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-chlorobenzamide.
| Compound Name | N-[5-(butan-2-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 133201796 |
| Molecular Formula | C13H15ClN4O3S2 |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | N-[5-(butan-2-ylsulfamoyl)-1,3,4-thiadiazol-2-yl]-2-chlorobenzamide |
| SMILES | CCC(C)NS(=O)(=O)c1nnc(NC(=O)c2ccccc2Cl)s1 |
| InChI | InChI=1S/C13H15ClN4O3S2/c1-3-8(2)18-23(20,21)13-17-16-12(22-13)15-11(19)9-6-4-5-7-10(9)14/h4-8,18H,3H2,1-2H3,(H,15,16,19) |
| InChIKey | BIJNUPMRBQZCKS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|