C23H26ClN5O3S2 — CID 133185016
2-chloro-N-[5-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 133185016) has the molecular formula C23H26ClN5O3S2 and a molecular weight of 520.08 g/mol. Its IUPAC name is 2-chloro-N-[5-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 133185016 |
| Molecular Formula | C23H26ClN5O3S2 |
| Molecular Weight | 520.08 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | 2-chloro-N-[5-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CC1CCN(c2ccc(C(C)NS(=O)(=O)c3nnc(NC(=O)c4ccccc4Cl)s3)cc2)CC1 |
| InChI | InChI=1S/C23H26ClN5O3S2/c1-15-11-13-29(14-12-15)18-9-7-17(8-10-18)16(2)28-34(31,32)23-27-26-22(33-23)25-21(30)19-5-3-4-6-20(19)24/h3-10,15-16,28H,11-14H2,1-2H3,(H,25,26,30) |
| InChIKey | UFWOXOUUFVPVCU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.08 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|