C20H29N5O3S2 — CID 125052572
2-methyl-N-[5-[[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 125052572) has the molecular formula C20H29N5O3S2 and a molecular weight of 451.62 g/mol. Its IUPAC name is 2-methyl-N-[5-[[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 2-methyl-N-[5-[[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 125052572 |
| Molecular Formula | C20H29N5O3S2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-methyl-N-[5-[[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CC(C)C(=O)Nc1nnc(S(=O)(=O)N[C@@H](C)c2ccc(N3CCC[C@H](C)C3)cc2)s1 |
| InChI | InChI=1S/C20H29N5O3S2/c1-13(2)18(26)21-19-22-23-20(29-19)30(27,28)24-15(4)16-7-9-17(10-8-16)25-11-5-6-14(3)12-25/h7-10,13-15,24H,5-6,11-12H2,1-4H3,(H,21,22,26)/t14-,15-/m0/s1 |
| InChIKey | ILQJJZFERCRFEA-GJZGRUSLSA-N |
| XLogP | 3.41 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|