C22H24ClN5O3S2 — CID 100715371
4-chloro-N-[5-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100715371) has the molecular formula C22H24ClN5O3S2 and a molecular weight of 506.05 g/mol. Its IUPAC name is 4-chloro-N-[5-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[5-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100715371 |
| Molecular Formula | C22H24ClN5O3S2 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 4-chloro-N-[5-[[4-[(3R)-3-methylpiperidin-1-yl]phenyl]methylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | C[C@@H]1CCCN(c2ccc(CNS(=O)(=O)c3nnc(NC(=O)c4ccc(Cl)cc4)s3)cc2)C1 |
| InChI | InChI=1S/C22H24ClN5O3S2/c1-15-3-2-12-28(14-15)19-10-4-16(5-11-19)13-24-33(30,31)22-27-26-21(32-22)25-20(29)17-6-8-18(23)9-7-17/h4-11,15,24H,2-3,12-14H2,1H3,(H,25,26,29)/t15-/m1/s1 |
| InChIKey | WBHYNERPBNOWHV-OAHLLOKOSA-N |
| XLogP | 4.16 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|