C19H22Cl2N2O2S — CID 132664382
2,5-dichloro-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 132664382) has the molecular formula C19H22Cl2N2O2S and a molecular weight of 413.37 g/mol. Its IUPAC name is 2,5-dichloro-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 132664382 |
| Molecular Formula | C19H22Cl2N2O2S |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 2,5-dichloro-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | CC1CCCN(c2ccc(CNS(=O)(=O)c3cc(Cl)ccc3Cl)cc2)C1 |
| InChI | InChI=1S/C19H22Cl2N2O2S/c1-14-3-2-10-23(13-14)17-7-4-15(5-8-17)12-22-26(24,25)19-11-16(20)6-9-18(19)21/h4-9,11,14,22H,2-3,10,12-13H2,1H3 |
| InChIKey | HISWUPUQVWCNJE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|