C24H33N3O3S2 — CID 133184701
2-methyl-N-[5-[[4-(3-methylpiperidin-1-yl)phenyl]methylsulfamoyl]-2-methylsulfanylphenyl]propanamide (PubChem CID 133184701) has the molecular formula C24H33N3O3S2 and a molecular weight of 475.68 g/mol. Its IUPAC name is 2-methyl-N-[5-[[4-(3-methylpiperidin-1-yl)phenyl]methylsulfamoyl]-2-methylsulfanylphenyl]propanamide.
| Compound Name | 2-methyl-N-[5-[[4-(3-methylpiperidin-1-yl)phenyl]methylsulfamoyl]-2-methylsulfanylphenyl]propanamide |
|---|---|
| PubChem CID | 133184701 |
| Molecular Formula | C24H33N3O3S2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 2-methyl-N-[5-[[4-(3-methylpiperidin-1-yl)phenyl]methylsulfamoyl]-2-methylsulfanylphenyl]propanamide |
| SMILES | CSc1ccc(S(=O)(=O)NCc2ccc(N3CCCC(C)C3)cc2)cc1NC(=O)C(C)C |
| InChI | InChI=1S/C24H33N3O3S2/c1-17(2)24(28)26-22-14-21(11-12-23(22)31-4)32(29,30)25-15-19-7-9-20(10-8-19)27-13-5-6-18(3)16-27/h7-12,14,17-18,25H,5-6,13,15-16H2,1-4H3,(H,26,28) |
| InChIKey | MTWNMEUHSNZLNW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|