C21H28N2O2S — CID 132655966
2,5-dimethyl-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 132655966) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is 2,5-dimethyl-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 132655966 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 2,5-dimethyl-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCc2ccc(N3CCCC(C)C3)cc2)c1 |
| InChI | InChI=1S/C21H28N2O2S/c1-16-6-7-18(3)21(13-16)26(24,25)22-14-19-8-10-20(11-9-19)23-12-4-5-17(2)15-23/h6-11,13,17,22H,4-5,12,14-15H2,1-3H3 |
| InChIKey | JHMHOXVLUVWPFC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|