C19H24N2O2S — CID 110640329
2,5-dimethyl-N-[(1-phenylpyrrolidin-3-yl)methyl]benzenesulfonamide (PubChem CID 110640329) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 2,5-dimethyl-N-[(1-phenylpyrrolidin-3-yl)methyl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[(1-phenylpyrrolidin-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110640329 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2,5-dimethyl-N-[(1-phenylpyrrolidin-3-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCC2CCN(c3ccccc3)C2)c1 |
| InChI | InChI=1S/C19H24N2O2S/c1-15-8-9-16(2)19(12-15)24(22,23)20-13-17-10-11-21(14-17)18-6-4-3-5-7-18/h3-9,12,17,20H,10-11,13-14H2,1-2H3 |
| InChIKey | ODGHXBLRPZRRNF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |