C17H18Cl2N2O2S — CID 110640667
2-chloro-N-[[1-(4-chlorophenyl)pyrrolidin-3-yl]methyl]benzenesulfonamide (PubChem CID 110640667) has the molecular formula C17H18Cl2N2O2S and a molecular weight of 385.32 g/mol. Its IUPAC name is 2-chloro-N-[[1-(4-chlorophenyl)pyrrolidin-3-yl]methyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[[1-(4-chlorophenyl)pyrrolidin-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110640667 |
| Molecular Formula | C17H18Cl2N2O2S |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 2-chloro-N-[[1-(4-chlorophenyl)pyrrolidin-3-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCN(c2ccc(Cl)cc2)C1)c1ccccc1Cl |
| InChI | InChI=1S/C17H18Cl2N2O2S/c18-14-5-7-15(8-6-14)21-10-9-13(12-21)11-20-24(22,23)17-4-2-1-3-16(17)19/h1-8,13,20H,9-12H2 |
| InChIKey | XBMQYZDBIKPHKH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |