C16H23ClN2O2S2 — CID 91813135
2-chloro-N-[[1-(thiolan-3-yl)piperidin-4-yl]methyl]benzenesulfonamide (PubChem CID 91813135) has the molecular formula C16H23ClN2O2S2 and a molecular weight of 374.96 g/mol. Its IUPAC name is 2-chloro-N-[[1-(thiolan-3-yl)piperidin-4-yl]methyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[[1-(thiolan-3-yl)piperidin-4-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91813135 |
| Molecular Formula | C16H23ClN2O2S2 |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-chloro-N-[[1-(thiolan-3-yl)piperidin-4-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCN(C2CCSC2)CC1)c1ccccc1Cl |
| InChI | InChI=1S/C16H23ClN2O2S2/c17-15-3-1-2-4-16(15)23(20,21)18-11-13-5-8-19(9-6-13)14-7-10-22-12-14/h1-4,13-14,18H,5-12H2 |
| InChIKey | OAKQJWGHLRXPPW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |