C17H25FN2O2S2 — CID 100682994
4-fluoro-3-methyl-N-[[1-[(3S)-thiolan-3-yl]piperidin-4-yl]methyl]benzenesulfonamide (PubChem CID 100682994) has the molecular formula C17H25FN2O2S2 and a molecular weight of 372.53 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[[1-[(3S)-thiolan-3-yl]piperidin-4-yl]methyl]benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-N-[[1-[(3S)-thiolan-3-yl]piperidin-4-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 100682994 |
| Molecular Formula | C17H25FN2O2S2 |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 4-fluoro-3-methyl-N-[[1-[(3S)-thiolan-3-yl]piperidin-4-yl]methyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC2CCN([C@H]3CCSC3)CC2)ccc1F |
| InChI | InChI=1S/C17H25FN2O2S2/c1-13-10-16(2-3-17(13)18)24(21,22)19-11-14-4-7-20(8-5-14)15-6-9-23-12-15/h2-3,10,14-15,19H,4-9,11-12H2,1H3/t15-/m0/s1 |
| InChIKey | HJTKWIRHNVUENE-HNNXBMFYSA-N |
| XLogP | 2.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |