C18H27FN2O2S2 — CID 91814267
1-(2-fluorophenyl)-N-[[1-(thian-4-yl)piperidin-4-yl]methyl]methanesulfonamide (PubChem CID 91814267) has the molecular formula C18H27FN2O2S2 and a molecular weight of 386.56 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[[1-(thian-4-yl)piperidin-4-yl]methyl]methanesulfonamide.
| Compound Name | 1-(2-fluorophenyl)-N-[[1-(thian-4-yl)piperidin-4-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 91814267 |
| Molecular Formula | C18H27FN2O2S2 |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[[1-(thian-4-yl)piperidin-4-yl]methyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1F)NCC1CCN(C2CCSCC2)CC1 |
| InChI | InChI=1S/C18H27FN2O2S2/c19-18-4-2-1-3-16(18)14-25(22,23)20-13-15-5-9-21(10-6-15)17-7-11-24-12-8-17/h1-4,15,17,20H,5-14H2 |
| InChIKey | QPUXHFIGTFPWTC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |