C17H25FN2O2S — CID 16887715
N-[(1-cyclopentylpiperidin-4-yl)methyl]-3-fluorobenzenesulfonamide (PubChem CID 16887715) has the molecular formula C17H25FN2O2S and a molecular weight of 340.46 g/mol. Its IUPAC name is N-[(1-cyclopentylpiperidin-4-yl)methyl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[(1-cyclopentylpiperidin-4-yl)methyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 16887715 |
| Molecular Formula | C17H25FN2O2S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-[(1-cyclopentylpiperidin-4-yl)methyl]-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCN(C2CCCC2)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H25FN2O2S/c18-15-4-3-7-17(12-15)23(21,22)19-13-14-8-10-20(11-9-14)16-5-1-2-6-16/h3-4,7,12,14,16,19H,1-2,5-6,8-11,13H2 |
| InChIKey | CHONRDBATNRYQZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |