C12H16ClNO2S — CID 43066015
3-chloro-N-(cyclopentylmethyl)benzenesulfonamide (PubChem CID 43066015) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is 3-chloro-N-(cyclopentylmethyl)benzenesulfonamide.
| Compound Name | 3-chloro-N-(cyclopentylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43066015 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-chloro-N-(cyclopentylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO2S/c13-11-6-3-7-12(8-11)17(15,16)14-9-10-4-1-2-5-10/h3,6-8,10,14H,1-2,4-5,9H2 |
| InChIKey | RWYFJLJTGPMPPF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |