C10H11Cl2NO2S — CID 2799391
3,5-dichloro-N-(cyclopropylmethyl)benzenesulfonamide (PubChem CID 2799391) has the molecular formula C10H11Cl2NO2S and a molecular weight of 280.18 g/mol. Its IUPAC name is 3,5-dichloro-N-(cyclopropylmethyl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-(cyclopropylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2799391 |
| Molecular Formula | C10H11Cl2NO2S |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 3,5-dichloro-N-(cyclopropylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CC1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NO2S/c11-8-3-9(12)5-10(4-8)16(14,15)13-6-7-1-2-7/h3-5,7,13H,1-2,6H2 |
| InChIKey | DLPYSOHKEICUBY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |