C8H8Cl3NO2S — CID 61287690
3,5-dichloro-N-(2-chloroethyl)benzenesulfonamide (PubChem CID 61287690) has the molecular formula C8H8Cl3NO2S and a molecular weight of 288.58 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-chloroethyl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-(2-chloroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61287690 |
| Molecular Formula | C8H8Cl3NO2S |
| Molecular Weight | 288.58 g/mol |
| Exact Mass | 286.93 |
| IUPAC Name | 3,5-dichloro-N-(2-chloroethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCl)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H8Cl3NO2S/c9-1-2-12-15(13,14)8-4-6(10)3-7(11)5-8/h3-5,12H,1-2H2 |
| InChIKey | MOONXZQHLIRJRE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.58 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|