C9H10Cl2N4O2S — CID 61343464
N-(3-azidopropyl)-3,5-dichlorobenzenesulfonamide (PubChem CID 61343464) has the molecular formula C9H10Cl2N4O2S and a molecular weight of 309.18 g/mol. Its IUPAC name is N-(3-azidopropyl)-3,5-dichlorobenzenesulfonamide.
| Compound Name | N-(3-azidopropyl)-3,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 61343464 |
| Molecular Formula | C9H10Cl2N4O2S |
| Molecular Weight | 309.18 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | N-(3-azidopropyl)-3,5-dichlorobenzenesulfonamide |
| SMILES | [N-]=[N+]=NCCCNS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N4O2S/c10-7-4-8(11)6-9(5-7)18(16,17)14-3-1-2-13-15-12/h4-6,14H,1-3H2 |
| InChIKey | SWQAAOGMKOIJPJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.18 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|