C11H15FN4O2S — CID 107328410
N-(3-azidopropyl)-4-fluoro-2,6-dimethylbenzenesulfonamide (PubChem CID 107328410) has the molecular formula C11H15FN4O2S and a molecular weight of 286.33 g/mol. Its IUPAC name is N-(3-azidopropyl)-4-fluoro-2,6-dimethylbenzenesulfonamide.
| Compound Name | N-(3-azidopropyl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107328410 |
| Molecular Formula | C11H15FN4O2S |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-(3-azidopropyl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)NCCCN=[N+]=[N-] |
| InChI | InChI=1S/C11H15FN4O2S/c1-8-6-10(12)7-9(2)11(8)19(17,18)15-5-3-4-14-16-13/h6-7,15H,3-5H2,1-2H3 |
| InChIKey | BHWKUIPVFXRHBE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|