C15H24FN3O2S — CID 120706430
4-fluoro-2,6-dimethyl-N-(3-piperazin-1-ylpropyl)benzenesulfonamide (PubChem CID 120706430) has the molecular formula C15H24FN3O2S and a molecular weight of 329.44 g/mol. Its IUPAC name is 4-fluoro-2,6-dimethyl-N-(3-piperazin-1-ylpropyl)benzenesulfonamide.
| Compound Name | 4-fluoro-2,6-dimethyl-N-(3-piperazin-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120706430 |
| Molecular Formula | C15H24FN3O2S |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4-fluoro-2,6-dimethyl-N-(3-piperazin-1-ylpropyl)benzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)NCCCN1CCNCC1 |
| InChI | InChI=1S/C15H24FN3O2S/c1-12-10-14(16)11-13(2)15(12)22(20,21)18-4-3-7-19-8-5-17-6-9-19/h10-11,17-18H,3-9H2,1-2H3 |
| InChIKey | FTHGBJVCOLMAKC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|